C7H7BrF2N2O3S — CID 130069062
3-bromo-5-(difluoromethyl)-6-methoxypyridine-2-sulfonamide (PubChem CID 130069062) has the molecular formula C7H7BrF2N2O3S and a molecular weight of 317.11 g/mol. Its IUPAC name is 3-bromo-5-(difluoromethyl)-6-methoxypyridine-2-sulfonamide.
| Compound Name | 3-bromo-5-(difluoromethyl)-6-methoxypyridine-2-sulfonamide |
|---|---|
| PubChem CID | 130069062 |
| Molecular Formula | C7H7BrF2N2O3S |
| Molecular Weight | 317.11 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | 3-bromo-5-(difluoromethyl)-6-methoxypyridine-2-sulfonamide |
| SMILES | COc1nc(S(N)(=O)=O)c(Br)cc1C(F)F |
| InChI | InChI=1S/C7H7BrF2N2O3S/c1-15-6-3(5(9)10)2-4(8)7(12-6)16(11,13)14/h2,5H,1H3,(H2,11,13,14) |
| InChIKey | PCPLNQZKUQOKMG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.11 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |