C7H8F2N2O4S — CID 118801223
4-(difluoromethyl)-5-hydroxy-6-methoxypyridine-2-sulfonamide (PubChem CID 118801223) has the molecular formula C7H8F2N2O4S and a molecular weight of 254.21 g/mol. Its IUPAC name is 4-(difluoromethyl)-5-hydroxy-6-methoxypyridine-2-sulfonamide.
| Compound Name | 4-(difluoromethyl)-5-hydroxy-6-methoxypyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118801223 |
| Molecular Formula | C7H8F2N2O4S |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 4-(difluoromethyl)-5-hydroxy-6-methoxypyridine-2-sulfonamide |
| SMILES | COc1nc(S(N)(=O)=O)cc(C(F)F)c1O |
| InChI | InChI=1S/C7H8F2N2O4S/c1-15-7-5(12)3(6(8)9)2-4(11-7)16(10,13)14/h2,6,12H,1H3,(H2,10,13,14) |
| InChIKey | WTBAGWYMHODRGC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |