C6H8F2N4O2S — CID 118803869
5,6-diamino-4-(difluoromethyl)pyridine-2-sulfonamide (PubChem CID 118803869) has the molecular formula C6H8F2N4O2S and a molecular weight of 238.22 g/mol. Its IUPAC name is 5,6-diamino-4-(difluoromethyl)pyridine-2-sulfonamide.
| Compound Name | 5,6-diamino-4-(difluoromethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118803869 |
| Molecular Formula | C6H8F2N4O2S |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 5,6-diamino-4-(difluoromethyl)pyridine-2-sulfonamide |
| SMILES | Nc1nc(S(N)(=O)=O)cc(C(F)F)c1N |
| InChI | InChI=1S/C6H8F2N4O2S/c7-5(8)2-1-3(15(11,13)14)12-6(10)4(2)9/h1,5H,9H2,(H2,10,12)(H2,11,13,14) |
| InChIKey | DWMJPDHPXSQXJV-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |