C8H7F2N3O3S — CID 134664686
6-cyano-4-(difluoromethyl)-3-methoxypyridine-2-sulfonamide (PubChem CID 134664686) has the molecular formula C8H7F2N3O3S and a molecular weight of 263.22 g/mol. Its IUPAC name is 6-cyano-4-(difluoromethyl)-3-methoxypyridine-2-sulfonamide.
| Compound Name | 6-cyano-4-(difluoromethyl)-3-methoxypyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134664686 |
| Molecular Formula | C8H7F2N3O3S |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 6-cyano-4-(difluoromethyl)-3-methoxypyridine-2-sulfonamide |
| SMILES | COc1c(C(F)F)cc(C#N)nc1S(N)(=O)=O |
| InChI | InChI=1S/C8H7F2N3O3S/c1-16-6-5(7(9)10)2-4(3-11)13-8(6)17(12,14)15/h2,7H,1H3,(H2,12,14,15) |
| InChIKey | XGJXTCLYGZVEQI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |