C7H4F2N4O4S — CID 134676606
5-cyano-3-(difluoromethyl)-6-nitropyridine-2-sulfonamide (PubChem CID 134676606) has the molecular formula C7H4F2N4O4S and a molecular weight of 278.20 g/mol. Its IUPAC name is 5-cyano-3-(difluoromethyl)-6-nitropyridine-2-sulfonamide.
| Compound Name | 5-cyano-3-(difluoromethyl)-6-nitropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134676606 |
| Molecular Formula | C7H4F2N4O4S |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 5-cyano-3-(difluoromethyl)-6-nitropyridine-2-sulfonamide |
| SMILES | N#Cc1cc(C(F)F)c(S(N)(=O)=O)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4F2N4O4S/c8-5(9)4-1-3(2-10)6(13(14)15)12-7(4)18(11,16)17/h1,5H,(H2,11,16,17) |
| InChIKey | XQKUZNRTXWCOBT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|