C6H6F2N4O4S — CID 119011354
6-amino-5-(difluoromethyl)-2-nitropyridine-3-sulfonamide (PubChem CID 119011354) has the molecular formula C6H6F2N4O4S and a molecular weight of 268.20 g/mol. Its IUPAC name is 6-amino-5-(difluoromethyl)-2-nitropyridine-3-sulfonamide.
| Compound Name | 6-amino-5-(difluoromethyl)-2-nitropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 119011354 |
| Molecular Formula | C6H6F2N4O4S |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 6-amino-5-(difluoromethyl)-2-nitropyridine-3-sulfonamide |
| SMILES | Nc1nc([N+](=O)[O-])c(S(N)(=O)=O)cc1C(F)F |
| InChI | InChI=1S/C6H6F2N4O4S/c7-4(8)2-1-3(17(10,15)16)6(12(13)14)11-5(2)9/h1,4H,(H2,9,11)(H2,10,15,16) |
| InChIKey | POVPBTQYAYULCH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|