C6H5F2N3O4S — CID 118852112
4-(difluoromethyl)-6-nitropyridine-3-sulfonamide (PubChem CID 118852112) has the molecular formula C6H5F2N3O4S and a molecular weight of 253.19 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-nitropyridine-3-sulfonamide.
| Compound Name | 4-(difluoromethyl)-6-nitropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118852112 |
| Molecular Formula | C6H5F2N3O4S |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 4-(difluoromethyl)-6-nitropyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cnc([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C6H5F2N3O4S/c7-6(8)3-1-5(11(12)13)10-2-4(3)16(9,14)15/h1-2,6H,(H2,9,14,15) |
| InChIKey | NSVVDCZVYSKXTD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|