C7H7Br2NO2 — CID 23056693
2,3-dibromo-5,6-dimethoxypyridine (PubChem CID 23056693) has the molecular formula C7H7Br2NO2 and a molecular weight of 296.95 g/mol. Its IUPAC name is 2,3-dibromo-5,6-dimethoxypyridine.
| Compound Name | 2,3-dibromo-5,6-dimethoxypyridine |
|---|---|
| PubChem CID | 23056693 |
| Molecular Formula | C7H7Br2NO2 |
| Molecular Weight | 296.95 g/mol |
| Exact Mass | 294.88 |
| IUPAC Name | 2,3-dibromo-5,6-dimethoxypyridine |
| SMILES | COc1cc(Br)c(Br)nc1OC |
| InChI | InChI=1S/C7H7Br2NO2/c1-11-5-3-4(8)6(9)10-7(5)12-2/h3H,1-2H3 |
| InChIKey | OSULVQGSODZGMD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.95 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|