C8H8BrNO3 — CID 176871253
5-bromo-3,6-dimethoxypyridine-2-carbaldehyde (PubChem CID 176871253) has the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. Its IUPAC name is 5-bromo-3,6-dimethoxypyridine-2-carbaldehyde.
| Compound Name | 5-bromo-3,6-dimethoxypyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 176871253 |
| Molecular Formula | C8H8BrNO3 |
| Molecular Weight | 246.06 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | 5-bromo-3,6-dimethoxypyridine-2-carbaldehyde |
| SMILES | COc1cc(Br)c(OC)nc1C=O |
| InChI | InChI=1S/C8H8BrNO3/c1-12-7-3-5(9)8(13-2)10-6(7)4-11/h3-4H,1-2H3 |
| InChIKey | WPLZGFMJWCSPLZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.06 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|