C15H25NO2 — CID 155787492
2,3-ditert-butyl-5,6-dimethoxypyridine (PubChem CID 155787492) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2,3-ditert-butyl-5,6-dimethoxypyridine.
| Compound Name | 2,3-ditert-butyl-5,6-dimethoxypyridine |
|---|---|
| PubChem CID | 155787492 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2,3-ditert-butyl-5,6-dimethoxypyridine |
| SMILES | COc1cc(C(C)(C)C)c(C(C)(C)C)nc1OC |
| InChI | InChI=1S/C15H25NO2/c1-14(2,3)10-9-11(17-7)13(18-8)16-12(10)15(4,5)6/h9H,1-8H3 |
| InChIKey | TXYLZEJGHQHHMX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |