C7H7ClINO2 — CID 77230174
3-chloro-2-iodo-5,6-dimethoxypyridine (PubChem CID 77230174) has the molecular formula C7H7ClINO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is 3-chloro-2-iodo-5,6-dimethoxypyridine.
| Compound Name | 3-chloro-2-iodo-5,6-dimethoxypyridine |
|---|---|
| PubChem CID | 77230174 |
| Molecular Formula | C7H7ClINO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 298.92 |
| IUPAC Name | 3-chloro-2-iodo-5,6-dimethoxypyridine |
| SMILES | COc1cc(Cl)c(I)nc1OC |
| InChI | InChI=1S/C7H7ClINO2/c1-11-5-3-4(8)6(9)10-7(5)12-2/h3H,1-2H3 |
| InChIKey | KWNRLBWHPGFGAS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|