C10H13NO4 — CID 71300170
1-(2,5,6-trimethoxy-3-pyridinyl)ethanone (PubChem CID 71300170) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-(2,5,6-trimethoxy-3-pyridinyl)ethanone.
| Compound Name | 1-(2,5,6-trimethoxy-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 71300170 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(2,5,6-trimethoxy-3-pyridinyl)ethanone |
| SMILES | COc1cc(C(C)=O)c(OC)nc1OC |
| InChI | InChI=1S/C10H13NO4/c1-6(12)7-5-8(13-2)10(15-4)11-9(7)14-3/h5H,1-4H3 |
| InChIKey | ONQIZTWXVHAPDZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |