C11H16N2O5 — CID 71300148
N,2,5,6-tetramethoxy-N-methylpyridine-3-carboxamide (PubChem CID 71300148) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is N,2,5,6-tetramethoxy-N-methylpyridine-3-carboxamide.
| Compound Name | N,2,5,6-tetramethoxy-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71300148 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | N,2,5,6-tetramethoxy-N-methylpyridine-3-carboxamide |
| SMILES | COc1cc(C(=O)N(C)OC)c(OC)nc1OC |
| InChI | InChI=1S/C11H16N2O5/c1-13(18-5)11(14)7-6-8(15-2)10(17-4)12-9(7)16-3/h6H,1-5H3 |
| InChIKey | JHYIVTVMUJLJAO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|