C9H11ClN2O3 — CID 129138511
2-chloro-N,6-dimethoxy-N-methylpyridine-3-carboxamide (PubChem CID 129138511) has the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. Its IUPAC name is 2-chloro-N,6-dimethoxy-N-methylpyridine-3-carboxamide.
| Compound Name | 2-chloro-N,6-dimethoxy-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 129138511 |
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-chloro-N,6-dimethoxy-N-methylpyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N(C)OC)c(Cl)n1 |
| InChI | InChI=1S/C9H11ClN2O3/c1-12(15-3)9(13)6-4-5-7(14-2)11-8(6)10/h4-5H,1-3H3 |
| InChIKey | SBQLGDWAOAKGGM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|