C15H16ClN3O4S — CID 167917316
2-[(2-chloro-6-methoxypyridine-3-carbonyl)-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]propanoic acid (PubChem CID 167917316) has the molecular formula C15H16ClN3O4S and a molecular weight of 369.83 g/mol. Its IUPAC name is 2-[(2-chloro-6-methoxypyridine-3-carbonyl)-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]propanoic acid.
| Compound Name | 2-[(2-chloro-6-methoxypyridine-3-carbonyl)-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 167917316 |
| Molecular Formula | C15H16ClN3O4S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-[(2-chloro-6-methoxypyridine-3-carbonyl)-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]propanoic acid |
| SMILES | COc1ccc(C(=O)N(Cc2csc(C)n2)C(C)C(=O)O)c(Cl)n1 |
| InChI | InChI=1S/C15H16ClN3O4S/c1-8(15(21)22)19(6-10-7-24-9(2)17-10)14(20)11-4-5-12(23-3)18-13(11)16/h4-5,7-8H,6H2,1-3H3,(H,21,22) |
| InChIKey | PKGPGHJPJHLCKF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|