C11H17N3O3 — CID 118343976
5-(dimethylamino)-N,6-dimethoxy-N-methylpyridine-3-carboxamide (PubChem CID 118343976) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 5-(dimethylamino)-N,6-dimethoxy-N-methylpyridine-3-carboxamide.
| Compound Name | 5-(dimethylamino)-N,6-dimethoxy-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 118343976 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 5-(dimethylamino)-N,6-dimethoxy-N-methylpyridine-3-carboxamide |
| SMILES | COc1ncc(C(=O)N(C)OC)cc1N(C)C |
| InChI | InChI=1S/C11H17N3O3/c1-13(2)9-6-8(7-12-10(9)16-4)11(15)14(3)17-5/h6-7H,1-5H3 |
| InChIKey | PTHGHSWSARNCDF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|