C12H10F2N2O2 — CID 134393289
6,7-difluoro-N-methoxy-N-methylquinoline-3-carboxamide (PubChem CID 134393289) has the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. Its IUPAC name is 6,7-difluoro-N-methoxy-N-methylquinoline-3-carboxamide.
| Compound Name | 6,7-difluoro-N-methoxy-N-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 134393289 |
| Molecular Formula | C12H10F2N2O2 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 6,7-difluoro-N-methoxy-N-methylquinoline-3-carboxamide |
| SMILES | CON(C)C(=O)c1cnc2cc(F)c(F)cc2c1 |
| InChI | InChI=1S/C12H10F2N2O2/c1-16(18-2)12(17)8-3-7-4-9(13)10(14)5-11(7)15-6-8/h3-6H,1-2H3 |
| InChIKey | JLNMHUZPZNWIHU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|