C17H21N3O3 — CID 159365691
N-methoxy-N,6-dimethylpyridine-3-carboxamide;1-(6-methyl-3-pyridinyl)ethanone (PubChem CID 159365691) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-methoxy-N,6-dimethylpyridine-3-carboxamide;1-(6-methyl-3-pyridinyl)ethanone.
| Compound Name | N-methoxy-N,6-dimethylpyridine-3-carboxamide;1-(6-methyl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 159365691 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-methoxy-N,6-dimethylpyridine-3-carboxamide;1-(6-methyl-3-pyridinyl)ethanone |
| SMILES | CC(=O)c1ccc(C)nc1.CON(C)C(=O)c1ccc(C)nc1 |
| InChI | InChI=1S/C9H12N2O2.C8H9NO/c1-7-4-5-8(6-10-7)9(12)11(2)13-3;1-6-3-4-8(5-9-6)7(2)10/h4-6H,1-3H3;3-5H,1-2H3 |
| InChIKey | LJCGVJYYYASVNG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|