C16H22N2O2 — CID 159310249
toluene;N,N,6-trimethylpyridine-3-carboxamide;hydrate (PubChem CID 159310249) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is toluene;N,N,6-trimethylpyridine-3-carboxamide;hydrate.
| Compound Name | toluene;N,N,6-trimethylpyridine-3-carboxamide;hydrate |
|---|---|
| PubChem CID | 159310249 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | toluene;N,N,6-trimethylpyridine-3-carboxamide;hydrate |
| SMILES | Cc1ccc(C(=O)N(C)C)cn1.Cc1ccccc1.O |
| InChI | InChI=1S/C9H12N2O.C7H8.H2O/c1-7-4-5-8(6-10-7)9(12)11(2)3;1-7-5-3-2-4-6-7;/h4-6H,1-3H3;2-6H,1H3;1H2 |
| InChIKey | VIIVAKPMAJHQPL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |