C9H12N2O3 — CID 174786229
5,6-dimethoxy-2-methylpyridine-3-carboxamide (PubChem CID 174786229) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 5,6-dimethoxy-2-methylpyridine-3-carboxamide.
| Compound Name | 5,6-dimethoxy-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 174786229 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 5,6-dimethoxy-2-methylpyridine-3-carboxamide |
| SMILES | COc1cc(C(N)=O)c(C)nc1OC |
| InChI | InChI=1S/C9H12N2O3/c1-5-6(8(10)12)4-7(13-2)9(11-5)14-3/h4H,1-3H3,(H2,10,12) |
| InChIKey | AQQIQLOEWISVOV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |