C9H11F2NO2 — CID 130100894
2-(difluoromethyl)-5,6-dimethoxy-3-methylpyridine (PubChem CID 130100894) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-(difluoromethyl)-5,6-dimethoxy-3-methylpyridine.
| Compound Name | 2-(difluoromethyl)-5,6-dimethoxy-3-methylpyridine |
|---|---|
| PubChem CID | 130100894 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-(difluoromethyl)-5,6-dimethoxy-3-methylpyridine |
| SMILES | COc1cc(C)c(C(F)F)nc1OC |
| InChI | InChI=1S/C9H11F2NO2/c1-5-4-6(13-2)9(14-3)12-7(5)8(10)11/h4,8H,1-3H3 |
| InChIKey | MNBPAUFAMYURMY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |