About 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine
2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine (PubChem CID 130101210) has the molecular formula C9H11F2NO
and a molecular weight of 187.19 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine |
| PubChem CID | 130101210 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine |
| SMILES | COc1nc(C(F)F)c(C)cc1C |
| InChI | InChI=1S/C9H11F2NO/c1-5-4-6(2)9(13-3)12-7(5)8(10)11/h4,8H,1-3H3 |
| InChIKey | NGXYKAZUMYJXKB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine?
The IUPAC name of 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine (CID 130101210) is 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine.
What is the SMILES notation for 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine?
The canonical SMILES for 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine is COc1nc(C(F)F)c(C)cc1C.
What is the InChIKey of 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine?
The InChIKey is NGXYKAZUMYJXKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2NO/c1-5-4-6(2)9(13-3)12-7(5)8(10)11/h4,8H,1-3H3.
What are the key properties of 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine?
2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine has a molecular weight of 187.19 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-6-methoxy-3,5-dimethylpyridine is sourced from PubChem (CID 130101210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).