C8H10F2N2O2 — CID 130100784
6-(difluoromethyl)-2,5-dimethoxypyridin-3-amine (PubChem CID 130100784) has the molecular formula C8H10F2N2O2 and a molecular weight of 204.18 g/mol. Its IUPAC name is 6-(difluoromethyl)-2,5-dimethoxypyridin-3-amine.
| Compound Name | 6-(difluoromethyl)-2,5-dimethoxypyridin-3-amine |
|---|---|
| PubChem CID | 130100784 |
| Molecular Formula | C8H10F2N2O2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 6-(difluoromethyl)-2,5-dimethoxypyridin-3-amine |
| SMILES | COc1cc(N)c(OC)nc1C(F)F |
| InChI | InChI=1S/C8H10F2N2O2/c1-13-5-3-4(11)8(14-2)12-6(5)7(9)10/h3,7H,11H2,1-2H3 |
| InChIKey | HGZTUEAXEVOYAI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |