C9H11F2NO — CID 130101198
2-(difluoromethyl)-4-methoxy-3,6-dimethylpyridine (PubChem CID 130101198) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is 2-(difluoromethyl)-4-methoxy-3,6-dimethylpyridine.
| Compound Name | 2-(difluoromethyl)-4-methoxy-3,6-dimethylpyridine |
|---|---|
| PubChem CID | 130101198 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-(difluoromethyl)-4-methoxy-3,6-dimethylpyridine |
| SMILES | COc1cc(C)nc(C(F)F)c1C |
| InChI | InChI=1S/C9H11F2NO/c1-5-4-7(13-3)6(2)8(12-5)9(10)11/h4,9H,1-3H3 |
| InChIKey | WBTOHJPIYIHNOU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |