C8H6F5NO3 — CID 134660021
5-(difluoromethyl)-6-(hydroxymethyl)-2-(trifluoromethoxy)pyridin-3-ol (PubChem CID 134660021) has the molecular formula C8H6F5NO3 and a molecular weight of 259.13 g/mol. Its IUPAC name is 5-(difluoromethyl)-6-(hydroxymethyl)-2-(trifluoromethoxy)pyridin-3-ol.
| Compound Name | 5-(difluoromethyl)-6-(hydroxymethyl)-2-(trifluoromethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 134660021 |
| Molecular Formula | C8H6F5NO3 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 5-(difluoromethyl)-6-(hydroxymethyl)-2-(trifluoromethoxy)pyridin-3-ol |
| SMILES | OCc1nc(OC(F)(F)F)c(O)cc1C(F)F |
| InChI | InChI=1S/C8H6F5NO3/c9-6(10)3-1-5(16)7(14-4(3)2-15)17-8(11,12)13/h1,6,15-16H,2H2 |
| InChIKey | UNCMHOCEGSRVKP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |