C8H6F6N2O2 — CID 134680204
6-(aminomethyl)-2-(trifluoromethoxy)-5-(trifluoromethyl)pyridin-3-ol (PubChem CID 134680204) has the molecular formula C8H6F6N2O2 and a molecular weight of 276.14 g/mol. Its IUPAC name is 6-(aminomethyl)-2-(trifluoromethoxy)-5-(trifluoromethyl)pyridin-3-ol.
| Compound Name | 6-(aminomethyl)-2-(trifluoromethoxy)-5-(trifluoromethyl)pyridin-3-ol |
|---|---|
| PubChem CID | 134680204 |
| Molecular Formula | C8H6F6N2O2 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 6-(aminomethyl)-2-(trifluoromethoxy)-5-(trifluoromethyl)pyridin-3-ol |
| SMILES | NCc1nc(OC(F)(F)F)c(O)cc1C(F)(F)F |
| InChI | InChI=1S/C8H6F6N2O2/c9-7(10,11)3-1-5(17)6(16-4(3)2-15)18-8(12,13)14/h1,17H,2,15H2 |
| InChIKey | RTASGOGQMWPLQY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |