C8H7F5N2O2 — CID 118842664
6-(aminomethyl)-2-(difluoromethyl)-5-(trifluoromethoxy)pyridin-3-ol (PubChem CID 118842664) has the molecular formula C8H7F5N2O2 and a molecular weight of 258.15 g/mol. Its IUPAC name is 6-(aminomethyl)-2-(difluoromethyl)-5-(trifluoromethoxy)pyridin-3-ol.
| Compound Name | 6-(aminomethyl)-2-(difluoromethyl)-5-(trifluoromethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 118842664 |
| Molecular Formula | C8H7F5N2O2 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 6-(aminomethyl)-2-(difluoromethyl)-5-(trifluoromethoxy)pyridin-3-ol |
| SMILES | NCc1nc(C(F)F)c(O)cc1OC(F)(F)F |
| InChI | InChI=1S/C8H7F5N2O2/c9-7(10)6-4(16)1-5(3(2-14)15-6)17-8(11,12)13/h1,7,16H,2,14H2 |
| InChIKey | CWRCECYKTLXVBN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |