C9H8F5N3O2 — CID 118808662
6-(aminomethyl)-2-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carboxamide (PubChem CID 118808662) has the molecular formula C9H8F5N3O2 and a molecular weight of 285.17 g/mol. Its IUPAC name is 6-(aminomethyl)-2-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carboxamide.
| Compound Name | 6-(aminomethyl)-2-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118808662 |
| Molecular Formula | C9H8F5N3O2 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 6-(aminomethyl)-2-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carboxamide |
| SMILES | NCc1nc(C(F)F)c(C(N)=O)cc1OC(F)(F)F |
| InChI | InChI=1S/C9H8F5N3O2/c10-7(11)6-3(8(16)18)1-5(4(2-15)17-6)19-9(12,13)14/h1,7H,2,15H2,(H2,16,18) |
| InChIKey | WUZYAIRZVNIUJW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |