C8H4BrF5INO — CID 118838243
2-(bromomethyl)-6-(difluoromethyl)-5-iodo-3-(trifluoromethoxy)pyridine (PubChem CID 118838243) has the molecular formula C8H4BrF5INO and a molecular weight of 431.92 g/mol. Its IUPAC name is 2-(bromomethyl)-6-(difluoromethyl)-5-iodo-3-(trifluoromethoxy)pyridine.
| Compound Name | 2-(bromomethyl)-6-(difluoromethyl)-5-iodo-3-(trifluoromethoxy)pyridine |
|---|---|
| PubChem CID | 118838243 |
| Molecular Formula | C8H4BrF5INO |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 430.84 |
| IUPAC Name | 2-(bromomethyl)-6-(difluoromethyl)-5-iodo-3-(trifluoromethoxy)pyridine |
| SMILES | FC(F)c1nc(CBr)c(OC(F)(F)F)cc1I |
| InChI | InChI=1S/C8H4BrF5INO/c9-2-4-5(17-8(12,13)14)1-3(15)6(16-4)7(10)11/h1,7H,2H2 |
| InChIKey | PYDGLSGVNSJROU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|