C8H5F3INO4 — CID 134680320
2-[5-hydroxy-3-iodo-6-(trifluoromethoxy)-2-pyridinyl]acetic acid (PubChem CID 134680320) has the molecular formula C8H5F3INO4 and a molecular weight of 363.03 g/mol. Its IUPAC name is 2-[5-hydroxy-3-iodo-6-(trifluoromethoxy)-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-hydroxy-3-iodo-6-(trifluoromethoxy)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134680320 |
| Molecular Formula | C8H5F3INO4 |
| Molecular Weight | 363.03 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | 2-[5-hydroxy-3-iodo-6-(trifluoromethoxy)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1nc(OC(F)(F)F)c(O)cc1I |
| InChI | InChI=1S/C8H5F3INO4/c9-8(10,11)17-7-5(14)1-3(12)4(13-7)2-6(15)16/h1,14H,2H2,(H,15,16) |
| InChIKey | GYYXHPRKMBVZIM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.03 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|