C9H8F6N2O2 — CID 118831104
[6-(aminomethyl)-5-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]methanol (PubChem CID 118831104) has the molecular formula C9H8F6N2O2 and a molecular weight of 290.16 g/mol. Its IUPAC name is [6-(aminomethyl)-5-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]methanol.
| Compound Name | [6-(aminomethyl)-5-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 118831104 |
| Molecular Formula | C9H8F6N2O2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [6-(aminomethyl)-5-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]methanol |
| SMILES | NCc1nc(CO)c(C(F)(F)F)cc1OC(F)(F)F |
| InChI | InChI=1S/C9H8F6N2O2/c10-8(11,12)4-1-7(19-9(13,14)15)5(2-16)17-6(4)3-18/h1,18H,2-3,16H2 |
| InChIKey | GJJWVJOZKKGTEX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |