C8H4F7NO2 — CID 134680686
[5-fluoro-3-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]methanol (PubChem CID 134680686) has the molecular formula C8H4F7NO2 and a molecular weight of 279.11 g/mol. Its IUPAC name is [5-fluoro-3-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]methanol.
| Compound Name | [5-fluoro-3-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 134680686 |
| Molecular Formula | C8H4F7NO2 |
| Molecular Weight | 279.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | [5-fluoro-3-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]methanol |
| SMILES | OCc1nc(C(F)(F)F)c(F)cc1OC(F)(F)F |
| InChI | InChI=1S/C8H4F7NO2/c9-3-1-5(18-8(13,14)15)4(2-17)16-6(3)7(10,11)12/h1,17H,2H2 |
| InChIKey | PMEZTJUZWZACSI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.11 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |