C8H4F6INO2 — CID 134677431
[5-iodo-4-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]methanol (PubChem CID 134677431) has the molecular formula C8H4F6INO2 and a molecular weight of 387.02 g/mol. Its IUPAC name is [5-iodo-4-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]methanol.
| Compound Name | [5-iodo-4-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 134677431 |
| Molecular Formula | C8H4F6INO2 |
| Molecular Weight | 387.02 g/mol |
| Exact Mass | 386.92 |
| IUPAC Name | [5-iodo-4-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]methanol |
| SMILES | OCc1cc(OC(F)(F)F)c(I)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H4F6INO2/c9-7(10,11)6-5(15)4(18-8(12,13)14)1-3(2-17)16-6/h1,17H,2H2 |
| InChIKey | GGLNQEHHTRABFY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.02 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|