C8H8F3IN2O — CID 118820077
[3-iodo-6-methyl-4-(trifluoromethoxy)-2-pyridinyl]methanamine (PubChem CID 118820077) has the molecular formula C8H8F3IN2O and a molecular weight of 332.06 g/mol. Its IUPAC name is [3-iodo-6-methyl-4-(trifluoromethoxy)-2-pyridinyl]methanamine.
| Compound Name | [3-iodo-6-methyl-4-(trifluoromethoxy)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 118820077 |
| Molecular Formula | C8H8F3IN2O |
| Molecular Weight | 332.06 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | [3-iodo-6-methyl-4-(trifluoromethoxy)-2-pyridinyl]methanamine |
| SMILES | Cc1cc(OC(F)(F)F)c(I)c(CN)n1 |
| InChI | InChI=1S/C8H8F3IN2O/c1-4-2-6(15-8(9,10)11)7(12)5(3-13)14-4/h2H,3,13H2,1H3 |
| InChIKey | PWQZNEZVSPJCPX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.06 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|