C9H6F7NO2 — CID 134669983
2-(fluoromethyl)-3-methoxy-5-(trifluoromethoxy)-6-(trifluoromethyl)pyridine (PubChem CID 134669983) has the molecular formula C9H6F7NO2 and a molecular weight of 293.14 g/mol. Its IUPAC name is 2-(fluoromethyl)-3-methoxy-5-(trifluoromethoxy)-6-(trifluoromethyl)pyridine.
| Compound Name | 2-(fluoromethyl)-3-methoxy-5-(trifluoromethoxy)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134669983 |
| Molecular Formula | C9H6F7NO2 |
| Molecular Weight | 293.14 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 2-(fluoromethyl)-3-methoxy-5-(trifluoromethoxy)-6-(trifluoromethyl)pyridine |
| SMILES | COc1cc(OC(F)(F)F)c(C(F)(F)F)nc1CF |
| InChI | InChI=1S/C9H6F7NO2/c1-18-5-2-6(19-9(14,15)16)7(8(11,12)13)17-4(5)3-10/h2H,3H2,1H3 |
| InChIKey | CIZCLMGJIMODNA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |