C8H4BrF6NO2 — CID 133087725
[6-bromo-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]methanol (PubChem CID 133087725) has the molecular formula C8H4BrF6NO2 and a molecular weight of 340.02 g/mol. Its IUPAC name is [6-bromo-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]methanol.
| Compound Name | [6-bromo-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 133087725 |
| Molecular Formula | C8H4BrF6NO2 |
| Molecular Weight | 340.02 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | [6-bromo-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]methanol |
| SMILES | OCc1nc(Br)cc(C(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C8H4BrF6NO2/c9-5-1-3(7(10,11)12)6(4(2-17)16-5)18-8(13,14)15/h1,17H,2H2 |
| InChIKey | ROQXNGWNIDUWDP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.02 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|