C8H8F4N2O2 — CID 118811822
[4-amino-6-(fluoromethyl)-3-(trifluoromethoxy)-2-pyridinyl]methanol (PubChem CID 118811822) has the molecular formula C8H8F4N2O2 and a molecular weight of 240.16 g/mol. Its IUPAC name is [4-amino-6-(fluoromethyl)-3-(trifluoromethoxy)-2-pyridinyl]methanol.
| Compound Name | [4-amino-6-(fluoromethyl)-3-(trifluoromethoxy)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 118811822 |
| Molecular Formula | C8H8F4N2O2 |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [4-amino-6-(fluoromethyl)-3-(trifluoromethoxy)-2-pyridinyl]methanol |
| SMILES | Nc1cc(CF)nc(CO)c1OC(F)(F)F |
| InChI | InChI=1S/C8H8F4N2O2/c9-2-4-1-5(13)7(6(3-15)14-4)16-8(10,11)12/h1,15H,2-3H2,(H2,13,14) |
| InChIKey | RWDGCWQQYVGPDS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |