C8H6ClF3N2O3 — CID 118811812
2-[4-amino-6-chloro-3-(trifluoromethoxy)-2-pyridinyl]acetic acid (PubChem CID 118811812) has the molecular formula C8H6ClF3N2O3 and a molecular weight of 270.59 g/mol. Its IUPAC name is 2-[4-amino-6-chloro-3-(trifluoromethoxy)-2-pyridinyl]acetic acid.
| Compound Name | 2-[4-amino-6-chloro-3-(trifluoromethoxy)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118811812 |
| Molecular Formula | C8H6ClF3N2O3 |
| Molecular Weight | 270.59 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 2-[4-amino-6-chloro-3-(trifluoromethoxy)-2-pyridinyl]acetic acid |
| SMILES | Nc1cc(Cl)nc(CC(=O)O)c1OC(F)(F)F |
| InChI | InChI=1S/C8H6ClF3N2O3/c9-5-1-3(13)7(17-8(10,11)12)4(14-5)2-6(15)16/h1H,2H2,(H2,13,14)(H,15,16) |
| InChIKey | PNQUTPYCLIODNU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.59 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|