C11H9F6NO4 — CID 134668453
methyl 2-[6-methoxy-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]acetate (PubChem CID 134668453) has the molecular formula C11H9F6NO4 and a molecular weight of 333.18 g/mol. Its IUPAC name is methyl 2-[6-methoxy-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]acetate.
| Compound Name | methyl 2-[6-methoxy-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134668453 |
| Molecular Formula | C11H9F6NO4 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | methyl 2-[6-methoxy-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1nc(OC)cc(C(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C11H9F6NO4/c1-20-7-3-5(10(12,13)14)9(22-11(15,16)17)6(18-7)4-8(19)21-2/h3H,4H2,1-2H3 |
| InChIKey | HNJUZMPYPXFVBZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |