C7H9F2N3O — CID 119025183
[2,6-diamino-5-(difluoromethyl)-3-pyridinyl]methanol (PubChem CID 119025183) has the molecular formula C7H9F2N3O and a molecular weight of 189.17 g/mol. Its IUPAC name is [2,6-diamino-5-(difluoromethyl)-3-pyridinyl]methanol.
| Compound Name | [2,6-diamino-5-(difluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 119025183 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | [2,6-diamino-5-(difluoromethyl)-3-pyridinyl]methanol |
| SMILES | Nc1nc(N)c(C(F)F)cc1CO |
| InChI | InChI=1S/C7H9F2N3O/c8-5(9)4-1-3(2-13)6(10)12-7(4)11/h1,5,13H,2H2,(H4,10,11,12) |
| InChIKey | PPACYWWTZZPBPR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |