C8H6F2IN3 — CID 119021329
2-[6-amino-5-(difluoromethyl)-2-iodo-3-pyridinyl]acetonitrile (PubChem CID 119021329) has the molecular formula C8H6F2IN3 and a molecular weight of 309.06 g/mol. Its IUPAC name is 2-[6-amino-5-(difluoromethyl)-2-iodo-3-pyridinyl]acetonitrile.
| Compound Name | 2-[6-amino-5-(difluoromethyl)-2-iodo-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 119021329 |
| Molecular Formula | C8H6F2IN3 |
| Molecular Weight | 309.06 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | 2-[6-amino-5-(difluoromethyl)-2-iodo-3-pyridinyl]acetonitrile |
| SMILES | N#CCc1cc(C(F)F)c(N)nc1I |
| InChI | InChI=1S/C8H6F2IN3/c9-6(10)5-3-4(1-2-12)7(11)14-8(5)13/h3,6H,1H2,(H2,13,14) |
| InChIKey | LWGNNUDYERDQBH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.06 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|