C7H8F2N2O — CID 119013180
[6-amino-4-(difluoromethyl)-3-pyridinyl]methanol (PubChem CID 119013180) has the molecular formula C7H8F2N2O and a molecular weight of 174.15 g/mol. Its IUPAC name is [6-amino-4-(difluoromethyl)-3-pyridinyl]methanol.
| Compound Name | [6-amino-4-(difluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 119013180 |
| Molecular Formula | C7H8F2N2O |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | [6-amino-4-(difluoromethyl)-3-pyridinyl]methanol |
| SMILES | Nc1cc(C(F)F)c(CO)cn1 |
| InChI | InChI=1S/C7H8F2N2O/c8-7(9)5-1-6(10)11-2-4(5)3-12/h1-2,7,12H,3H2,(H2,10,11) |
| InChIKey | KDEVIMCEJDJXAQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |