C12H7F5N2O — CID 133086551
[2-amino-5-(2,3,4,5,6-pentafluorophenyl)-4-pyridinyl]methanol (PubChem CID 133086551) has the molecular formula C12H7F5N2O and a molecular weight of 290.19 g/mol. Its IUPAC name is [2-amino-5-(2,3,4,5,6-pentafluorophenyl)-4-pyridinyl]methanol.
| Compound Name | [2-amino-5-(2,3,4,5,6-pentafluorophenyl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 133086551 |
| Molecular Formula | C12H7F5N2O |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [2-amino-5-(2,3,4,5,6-pentafluorophenyl)-4-pyridinyl]methanol |
| SMILES | Nc1cc(CO)c(-c2c(F)c(F)c(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C12H7F5N2O/c13-8-7(9(14)11(16)12(17)10(8)15)5-2-19-6(18)1-4(5)3-20/h1-2,20H,3H2,(H2,18,19) |
| InChIKey | LVTYSNSILPCHOL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|