C8H10F2N2O — CID 130098028
[5-(aminomethyl)-4-(difluoromethyl)-2-pyridinyl]methanol (PubChem CID 130098028) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is [5-(aminomethyl)-4-(difluoromethyl)-2-pyridinyl]methanol.
| Compound Name | [5-(aminomethyl)-4-(difluoromethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 130098028 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | [5-(aminomethyl)-4-(difluoromethyl)-2-pyridinyl]methanol |
| SMILES | NCc1cnc(CO)cc1C(F)F |
| InChI | InChI=1S/C8H10F2N2O/c9-8(10)7-1-6(4-13)12-3-5(7)2-11/h1,3,8,13H,2,4,11H2 |
| InChIKey | YMJJHMPMKHACQO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |