C12H19NO — CID 177367949
[4,5-di(propan-2-yl)-2-pyridinyl]methanol (PubChem CID 177367949) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is [4,5-di(propan-2-yl)-2-pyridinyl]methanol.
| Compound Name | [4,5-di(propan-2-yl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 177367949 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | [4,5-di(propan-2-yl)-2-pyridinyl]methanol |
| SMILES | CC(C)c1cnc(CO)cc1C(C)C |
| InChI | InChI=1S/C12H19NO/c1-8(2)11-5-10(7-14)13-6-12(11)9(3)4/h5-6,8-9,14H,7H2,1-4H3 |
| InChIKey | VUPGTIZNKIFDAC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |