C16H29N — CID 167652229
ethane;2,4,5-tri(propan-2-yl)pyridine (PubChem CID 167652229) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is ethane;2,4,5-tri(propan-2-yl)pyridine.
| Compound Name | ethane;2,4,5-tri(propan-2-yl)pyridine |
|---|---|
| PubChem CID | 167652229 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | ethane;2,4,5-tri(propan-2-yl)pyridine |
| SMILES | CC.CC(C)c1cc(C(C)C)c(C(C)C)cn1 |
| InChI | InChI=1S/C14H23N.C2H6/c1-9(2)12-7-14(11(5)6)15-8-13(12)10(3)4;1-2/h7-11H,1-6H3;1-2H3 |
| InChIKey | QSZDZZLBUOLHGI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |