C11H16N2S — CID 153396887
ethane;6-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 153396887) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is ethane;6-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | ethane;6-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 153396887 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | ethane;6-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | CC.CC(C)c1cc2ncsc2cn1 |
| InChI | InChI=1S/C9H10N2S.C2H6/c1-6(2)7-3-8-9(4-10-7)12-5-11-8;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | IICYKZBQCUSASR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |