C13H17N3 — CID 171735434
2,7-di(propan-2-yl)pyrido[4,3-d]pyrimidine (PubChem CID 171735434) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2,7-di(propan-2-yl)pyrido[4,3-d]pyrimidine.
| Compound Name | 2,7-di(propan-2-yl)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 171735434 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2,7-di(propan-2-yl)pyrido[4,3-d]pyrimidine |
| SMILES | CC(C)c1cc2nc(C(C)C)ncc2cn1 |
| InChI | InChI=1S/C13H17N3/c1-8(2)11-5-12-10(6-14-11)7-15-13(16-12)9(3)4/h5-9H,1-4H3 |
| InChIKey | FTVMBRPVPWCAHN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |