About ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine
ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine (PubChem CID 171660115) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine |
| PubChem CID | 171660115 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine |
| SMILES | CC.CC(C)c1cc2nc[nH]c2cn1.[H][H] |
| InChI | InChI=1S/C9H11N3.C2H6.H2/c1-6(2)7-3-8-9(4-10-7)12-5-11-8;1-2;/h3-6H,1-2H3,(H,11,12);1-2H3;1H |
| InChIKey | OHNHQPUVDXGKSP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine?
The IUPAC name of ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine (CID 171660115) is ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine.
What is the SMILES notation for ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine?
The canonical SMILES for ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine is CC.CC(C)c1cc2nc[nH]c2cn1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine?
The InChIKey is OHNHQPUVDXGKSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3.C2H6.H2/c1-6(2)7-3-8-9(4-10-7)12-5-11-8;1-2;/h3-6H,1-2H3,(H,11,12);1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine?
ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine has a molecular weight of 193.29 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;6-propan-2-yl-3H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 171660115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).