C12H9N3 — CID 76848036
6-phenyl-3H-imidazo[4,5-c]pyridine (PubChem CID 76848036) has the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 6-phenyl-3H-imidazo[4,5-c]pyridine.
| Compound Name | 6-phenyl-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 76848036 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 6-phenyl-3H-imidazo[4,5-c]pyridine |
| SMILES | c1ccc(-c2cc3nc[nH]c3cn2)cc1 |
| InChI | InChI=1S/C12H9N3/c1-2-4-9(5-3-1)10-6-11-12(7-13-10)15-8-14-11/h1-8H,(H,14,15) |
| InChIKey | WPSLKEHAOKNPSH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |